Amitryptyline, demethyl-
nortriptyline
CAS: 72-69-5
Molecular Formula: C19H21N
Amitryptyline, demethyl- - Names and Identifiers
| Name | nortriptyline |
| Synonyms | Ateben Avantyl allegron nortriptyline Amitryptyline, demethyl- 5-[3-(Methylamino)propylidene]dibenzo[a,E]cyclohepta[1,5]diene 5-(alpha-methylaminopropylidene)dibenzo[a,d]cyclohepta[1,4]diene 10,11-dihydro-5-(3-methylaminopropylidene)dibenzo(a,d)cycloheptene 3-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylidene)-N-methylpropan-1-amine 5h-dibenzo(a,d)cycloheptene-delta(5,gamma)-propylamine,10,11-dihydro-n-methyl 5H-Dibenzo[a,d]cycloheptene-delta5,gamma-propylamine, 10,11-dihydro-N-methyl- |
| CAS | 72-69-5 |
| EINECS | 200-788-8 |
| InChI | InChI=1/C19H21N/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19/h2-5,7-11,20H,6,12-14H2,1H3 |
Amitryptyline, demethyl- - Physico-chemical Properties
| Molecular Formula | C19H21N |
| Molar Mass | 263.38 |
| Density | 0.9790 (rough estimate) |
| Melting Point | 58 °C |
| Boling Point | 396.62°C (rough estimate) |
| Flash Point | 194.9°C |
| Vapor Presure | 1.02E-06mmHg at 25°C |
| pKa | pKa 9.7 (Uncertain) |
| Refractive Index | 1.4900 (estimate) |
Amitryptyline, demethyl- - Risk and Safety
| Toxicity | LD50 orl-rat: 502 mg/kg HEPHD2 55,527,80 |
